Sei sulla pagina 1di 18

Input Equation

Ca + H2O = Ca(OH)2 + H2

Balanced Equation
Ca + 2H2O = Ca(OH)2 + H2
CO2 + Ba(OH)2 = BaCO3 +
CO2+Ba(OH)2=BaCO3+H2O
H2O
4C3H9N + 25O2 = 12CO2 +
C3H9N + O2= CO2 + H2O + NO2
18H2O + 4NO2
2C3H7CHOHCH(C2H5)CH2O
C3H7CHOHCH(C2H5)CH2OH + O2 = CO2 + H2O
H + 23O2 = 16CO2 + 18H2O
CaO + 2HNO3 = H2O +
CaO + 2 HNO3 = H2O + Ca(NO3)2
Ca(NO3)2
Cu + 2AgNO3 = Cu(NO3)2 +
Cu + AgNO3 = Cu(NO3)2 + Ag
2Ag
2C5H10 + 15O2 = 10CO2 +
C5H10 + O2 = CO2 + H2O
10H2O
2C3H8O(l) + 9O2(g) =
C3H8O(l) + O2(g) =CO2(g) +H2O(l)
6CO2(g) + 8H2O(l)
Ca(OH)2 = CaO + H2O
Ca(OH)2 = CaO + H2O
Cu(OH)2=CuO+H2O
Cu(OH)2 = CuO + H2O
C2H6O+O2=CO2+H2O
C2H6O + 3O2 = 2CO2 + 3H2O
Ca3P2 + 6H2O = 3Ca(OH)2 +
Ca3P2+H2O=Ca(OH)2+PH3
2PH3
10Cu + 20HNO3 =
Cu + HNO3 = Cu(NO3)2 + NO2 + H20
10Cu(NO3)2 + 0NO2 + H20
10Cu + 20HNO3 =
Cu + HNO3 = Cu(NO3)2 + NO2 + H20
10Cu(NO3)2 + 0NO2 + H20
3CuO + 2NH3 = 3Cu + N2 +
CuO + NH3 = Cu + N2 + H2O
3H2O
Cu + 4HNO3 = Cu(NO3)2 +
Cu + HNO3 = Cu(NO3)2 + NO2 + H2O
2NO2 + 2H2O
5Cu + 12HNO3 = 5Cu(NO3)2
Cu + HNO3 = Cu(NO3)2 + N2 + H2O
+ N2 + 6H2O
CaCO3 + 2HCl = CaCl2 + H2O
CaCO3+HCl=CaCl2+H2O+CO2
+ CO2
2C4H10(g) + 13O2(g) =
C4H10(g) + O2(g) = CO2(g) + H2O(g)
8CO2(g) + 10H2O(g)
3Cu + 8HNO3 = 3Cu(NO3)2 +
Cu+HNO3=Cu(NO3)2+NO+H2O
2NO + 4H2O
2Ca3(PO4)2 + 6SiO2 + 10C =
Ca3(PO4)2+SiO2+C=CaSiO3+5CO+P4
6CaSiO3 + 10CO + P4
Cr2O3 + 3KNO3 + 2Na2CO3 =
Cr2O3 + KNO3 + Na2CO3 = Na2CrO4 + KNO2 + CO2
2Na2CrO4 + 3KNO2 + 2CO2
Cu + 4HNO3 = 2NO2 +
Cu + HNO3 = NO2 + Cu(NO3)2 +H2O
Cu(NO3)2 + 2H2O
2Cr2O7-- + 3C2H5OH + 16H+
Cr2O7-- + C2H5OH + H+ = CH3COOH + Cr+++ +H2O = 3CH3COOH + 4Cr+++ +
11H2O
2C4H10 + 13O2 = 8CO2 +
C4H10 + O2 = CO2 + H2O
10H2O

Cu + H2SO4 = CuS + CuSO4 + H2O


CH4 + O2 = CO2 + H20
C2H6 + O2 = CO2 + H2O
C2H6 + O2 = CO2 + H2O
C7H16 + 11 O2 = 2CO2 + H2O
C7H16 + 11 O2 = CO2 + H2O
C7H16 + 11 O2 = CO + H2O
C7H16 + 11 O2 = CO + HO
C3H7OH+O2=CO2+H20
CS2 + NH3 = NH4SCN + H2S
CS2 + NH3 = NH4SCN + H2S
CaC2 + H2O = Ca(OH)2 + C2H2
C3H8+O2=CO2+H2O
Cu(NO3)2+K2CO3=CuCO3+KNO3
Cu(NO3)+K(CO3)=CuCO3+KNO3
C+ CO2= CO
C4H6O + O2 = CO2 + H2O
C4H10 + O2 = CO2 + H2O
C8H16 + O2 = CO2 + H2O
Cu + H2SO4 = CuSO4 + SO2 + H2O
CuSO4 + KOH = Cu(OH)2 + K2SO4
CH4 + O2 = CO2 + H2O
CO + H2 = CH4 + H2O
C2H60+O2 =CO2+H2O
CaCO3+C = CaC2+CO2
CH4 + O2 = CO + H2O
CH4+Cl2 = CHCl3+HCl
Cu+AgNO3=Cu(NO3)2+Ag
C3H4+O2=CO2+H2O

4Cu + 4H2SO4 = CuS +


3CuSO4 + 4H2O
5CH4 + 5O2 = 5CO2 + H20
2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
C7H16 + 11O2 = 7CO2 +
8H2O
C7H16 + 11O2 = 7CO2 +
8H2O
2C7H16 + 15O2 = 14CO +
16H2O
2C7H16 + 23O2 = 14CO +
32HO
10C3H7OH + 25O2 = 30CO2
+ 4H20
CS2 + 2NH3 = NH4SCN +
H2S
CS2 + 2NH3 = NH4SCN +
H2S
CaC2 + 2H2O = Ca(OH)2 +
C2H2
C3H8 + 5O2 = 3CO2 + 4H2O
Cu(NO3)2 + K2CO3 = CuCO3
+ 2KNO3
Cu(NO3) + K(CO3) = CuCO3 +
KNO3
C + CO2 = 2CO
C4H6O + 5O2 = 4CO2 + 3H2O
2C4H10 + 13O2 = 8CO2 +
10H2O
C8H16 + 12O2 = 8CO2 +
8H2O
Cu + 2H2SO4 = CuSO4 + SO2
+ 2H2O
CuSO4 + 2KOH = Cu(OH)2 +
K2SO4
CH4 + 2O2 = CO2 + 2H2O
CO + 3H2 = CH4 + H2O
C2H60 + 17O2 = 2CO2 +
30H2O
2CaCO3 + 5C = 2CaC2 +
3CO2
2CH4 + 3O2 = 2CO + 4H2O
CH4 + 3Cl2 = CHCl3 + 3HCl
Cu + 2AgNO3 = Cu(NO3)2 +
2Ag
C3H4 + 4O2 = 3CO2 + 2H2O

C6H6 + O2 = CO2 + H2O


CH3CH2OH + O2 = H2O + CH3COOH
CH3(CH2)6CH3 +O2 = CO2+H2O
CH3(CH2)4CH3+O2=CO2+H2O
C6H6+O2=H2O+CO2
CH3(CH2)2CH3 +O2 = CO2+H2O
CuCl2 + H2O = CuCl2(H2O)
CO2+CaO = CaCO3
CH4+O2=CO2+H2O
Ca(HCO3)2 = CaCO3+H2O+CO2
CH4 + O2 = CO2 + H2O
CH4 + O2 = CO2 +H2O
CH3COOH+NaOH = CH3COO + H2O + Na
C2H5COOH + KMnO4 + H2SO4 = CO2 + MnSO4 +
K2SO4 + H2O
C2H5COOH + KMnO4 + H2SO4 = CO2 + MnSO4 +
K2SO4 + H2O
Cu + Ag+ = Cu+2 + Ag
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2
C4H10(g) + O2(g) = CO2(g) + H2O(g)
C2H6 + O2 = CO2 + H2O
CH3OH + O2 = CO2 + H2O
CH3OH(l) + O2(g) = CO2(g) + H2O(g)
Cs + Ca3(PO4)2 = Cs3PO4 + Ca
Cs + Ca3(PO4)2 = Cs3PO4 + Ca
C(s) + H2O(g) =H+CO2
C(s) + H2O(g) =H(aq)+CO2(aq)
Cs + Ca3(PO4)2 = Cs3PO4 + Ca2

2C6H6 + 15O2 = 12CO2 +


6H2O
CH3CH2OH + O2 = H2O +
CH3COOH
2CH3(CH2)6CH3 + 25O2 =
16CO2 + 18H2O
2CH3(CH2)4CH3 + 19O2 =
12CO2 + 14H2O
2C6H6 + 15O2 = 6H2O +
12CO2
2CH3(CH2)2CH3 + 13O2 =
8CO2 + 10H2O
CuCl2 + H2O = CuCl2(H2O)
CO2 + CaO = CaCO3
CH4 + 2O2 = CO2 + 2H2O
Ca(HCO3)2 = CaCO3 + H2O +
CO2
CH4 + 2O2 = CO2 + 2H2O
CH4 + 2O2 = CO2 + 2H2O
CH3COOH + NaOH =
CH3COO + H2O + Na
5C2H5COOH + 14KMnO4 +
21H2SO4 = 15CO2 +
14MnSO4 + 7K2SO4 + 36H2O
5C2H5COOH + 14KMnO4 +
21H2SO4 = 15CO2 +
14MnSO4 + 7K2SO4 + 36H2O
Cu + 2Ag+ = Cu+2 + 2Ag
2CrI3 + 64KOH + 27Cl2 =
2K2CrO4 + 6KIO4 + 54KCl +
32H2O
2CO2(g) + CaSiO3(s) + H2O(l)
= SiO2(s) + Ca(HCO3)2
2C4H10(g) + 13O2(g) =
8CO2(g) + 10H2O(g)
2C2H6 + 7O2 = 4CO2 + 6H2O
2CH3OH + 3O2 = 2CO2 +
4H2O
2CH3OH(l) + 3O2(g) =
2CO2(g) + 4H2O(g)
6Cs + Ca3(PO4)2 = 2Cs3PO4
+ 3Ca
6Cs + Ca3(PO4)2 = 2Cs3PO4
+ 3Ca
C(s) + 2H2O(g) = 4H + CO2
C(s) + 2H2O(g) = 4H(aq) +
CO2(aq)
12Cs + 2Ca3(PO4)2 =

C6H5Cl + O2 = CO + H2O + Cl2


C4H10+O2=CO2+H2O
CH4 + O2 = CO2 + H2O
C4H10+O2=CO2+H2O
C6H6(l) + O2(g) = CO2(g) + H2O(g)
CH4+Cl2=CH2Cl2+HCl
Cu+HCl=CuCl2+H2
Cr(s) + S8(s) =Cr2S3(s)
Cr(s) + S8(s) =Cr2S3(s)
C2H4O(l) + O2(g) = CO2(g) + H2O(g)
CO2+CaSiO3+H2O=SiO2+Ca(HCO3)2
C 6H 5Cl+ O 2= CO+ H 2O+ HCl
Cu(s) + HCl(aq)=CuCl(aq) + H2(g)
C6H12O6=C+H2O
Cs + Ca3(PO4)2 = Cs3PO4 + Ca2
CuSO4 + Ca3(PO4)2 = Cu3(PO4)2 + CaSO4
C4H10(g) + O2(g) = CO2(g) + H2O(g)
Cu(OH)2(s) = CuO(s) + H2O(g)
CuSO4(s) + H2O(l) = CuSO4 H2O
CaCl2(aq) + Na3PO4(aq) = Ca3(PO4)2(s) + NaCl(aq)
C2H4O+ O2 = CO2 + H2O
C6H6(l)+O2(g) =CO2(g)+H2O(l)
Cu + HNO3 = Cu(NO3)2 + NO + H2O
CH4 + O2= CO2 + H2O
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)
C3H8O3 + O2 = CO2 + H2O
C6H6 + O2 = H2O + CO2

4Cs3PO4 + 3Ca2
4C6H5Cl + 17O2 = 24CO +
10H2O + 2Cl2
2C4H10 + 13O2 = 8CO2 +
10H2O
CH4 + 2O2 = CO2 + 2H2O
2C4H10 + 13O2 = 8CO2 +
10H2O
2C6H6(l) + 15O2(g) =
12CO2(g) + 6H2O(g)
CH4 + 2Cl2 = CH2Cl2 + 2HCl
Cu + 2HCl = CuCl2 + H2
16Cr(s) + 3S8(s) = 8Cr2S3(s)
16Cr(s) + 3S8(s) = 8Cr2S3(s)
2C2H4O(l) + 5O2(g) =
4CO2(g) + 4H2O(g)
2CO2 + CaSiO3 + H2O = SiO2
+ Ca(HCO3)2
C6H5Cl + 4O2 = 6CO + 2H2O
+ HCl
2Cu(s) + 2HCl(aq) = 2CuCl(aq)
+ H2(g)
C6H12O6 = 6C + 6H2O
12Cs + 2Ca3(PO4)2 =
4Cs3PO4 + 3Ca2
3CuSO4 + Ca3(PO4)2 =
Cu3(PO4)2 + 3CaSO4
2C4H10(g) + 13O2(g) =
8CO2(g) + 10H2O(g)
Cu(OH)2(s) = CuO(s) +
H2O(g)
CuSO4(s) + H2O(l) =
CuSO4H2O
3CaCl2(aq) + 2Na3PO4(aq) =
Ca3(PO4)2(s) + 6NaCl(aq)
2C2H4O + 5O2 = 4CO2 +
4H2O
2C6H6(l) + 15O2(g) =
12CO2(g) + 6H2O(l)
3Cu + 8HNO3 = 3Cu(NO3)2 +
2NO + 4H2O
CH4 + 2O2 = CO2 + 2H2O
Cr2O3(s) + 3H2(g) = 2Cr(s) +
3H2O(g)
2C3H8O3 + 7O2 = 6CO2 +
8H2O
2C6H6 + 15O2 = 6H2O +
12CO2

CaCO3 = CaO + CO2


Cr2S3 + HCl = CrCl3 + H2S
C3H4(g)+O2(g)=CO2(g)+H2O(g)
C2H6+O2=CO2+H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)
Ca(s)+Br2(l)=CaBr(s)
C2H4Cl2 + O2 = CO2 + H2O +HCl
CaO(s) + H2O(l) =Ca(OH)2(s)
C2H6+O2=CO2+H2O
Cr(NO2)2+(NH4)2SO4=CrSO4+NH4NO2
C8H18 + O2 = CO2 + H2O
C3H8 + O2 = CO2 + H2O
C5H6O(l) + O2(g) = CO2(g) + H2O(l)
C3H6(g) + O2(g) = CO2(g) + H2O(l)
CO2+OH=CO3+H2O
CH5N + O2 = CO + H2O + NO2
CO2+H2O=CO3+H2O
C6H14 + O2 = CO2 + H2O
C2H5OH + H+ + MnO4- = CH3COOH + H2O + Mn
Ca(NO3)2 + H2O =Ca(NO)2 + H3O
C2H5OH + H+ + MnO4- = CH3COOH + H2O + Mn2+
Ca3N2 + H2O = Ca(OH)2 + NH3
C2H5Cl + NaPb = (C2H5)4Pb + NaCl + Pb
CaCO3 + HCl = CaCl2 + H2O + CO2
C7H16+11O2=7CO2+8H2O
Cr(s) + S8(s) = Cr2S3(s)
CH3OH(l) + O2(g) = CO2(g) + H2O(g)
Cu +2AgNO3 = Cu(NO3)2 + 2Ag

CaCO3 = CaO + CO2


Cr2S3 + 6HCl = 2CrCl3 +
3H2S
C3H4(g) + 4O2(g) = 3CO2(g) +
2H2O(g)
2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6(g) + 7O2(g) = 4CO2(g)
+ 6H2O(g)
2Ca(s) + Br2(l) = 2CaBr(s)
2C2H4Cl2 + 5O2 = 4CO2 +
2H2O + 4HCl
CaO(s) + H2O(l) = Ca(OH)2(s)
2C2H6 + 7O2 = 4CO2 + 6H2O
Cr(NO2)2 + (NH4)2SO4 =
CrSO4 + 2NH4NO2
2C8H18 + 25O2 = 16CO2 +
18H2O
C3H8 + 5O2 = 3CO2 + 4H2O
C5H6O(l) + 6O2(g) = 5CO2(g)
+ 3H2O(l)
2C3H6(g) + 9O2(g) = 6CO2(g)
+ 6H2O(l)
CO2 + 2OH = CO3 + H2O
4CH5N + 11O2 = 4CO +
10H2O + 4NO2
0CO2 + H2O = 0CO3 + H2O
2C6H14 + 19O2 = 12CO2 +
14H2O
7C2H5OH + 4H+ + 4MnO4- =
7CH3COOH + 9H2O + 4Mn
-1Ca(NO3)2 + 12H2O = 1Ca(NO)2 + 8H3O
13C2H5OH + 12H+ + 8MnO4= 13CH3COOH + 19H2O +
4Mn2+
Ca3N2 + 6H2O = 3Ca(OH)2 +
2NH3
4C2H5Cl + 4NaPb =
(C2H5)4Pb + 4NaCl + 3Pb
CaCO3 + 2HCl = CaCl2 + H2O
+ CO2
C7H16 + 11O2 = 7CO2 +
8H2O
16Cr(s) + 3S8(s) = 8Cr2S3(s)
2CH3OH(l) + 3O2(g) =
2CO2(g) + 4H2O(g)
Cu + 2AgNO3 = Cu(NO3)2 +
2Ag

CuSO4 + KI = CuI + KSO4


Cu + HNO3 = Cu(NO3)2 + NO + H2O
CuSO4(aq) + KI(s) = CuI(s) + I2(s) + K2SO4(aq)
C2H6 + O2 = CO2 + H2O
CaC2(s) + H2O(l) = Ca(OH)2(s) + C2H2(g)
CaC2(s) + H2O(l) = Ca(OH)2(s) + C2H2(g)
C2H5OH(l) + O2(g) = CO2(g) + H2O(l)
C2H6 + O2 = CO2 + H2O
CO2+OH = H +CO3
CH3OH + O2 = CO2 + H2O
CaH2(s) + H2O(g) = Ca(OH)2(s) + H2(g)
CaCO3 + HCl = H2O + CO2 + CaCl2
C6H14 + O2 = CO2 + H2O
C2H6 + O2 = CO2 + H2O
CaC2(s) + H2O(l) = Ca(OH)2(s) + C2H2(g)
CH4 + CCl4 = CH2Cl2
CH4 + O2 = CO2 + H2O
CO2 + KOH = K2CO3 + H2O
CH4 + 2O2 =CO2 + H2O
CO + O2 = CO2
CO2+H2O=C6H12O6+O2
C6H12O6(aq)=C2H6O (aq) + CO2(g)
C8H18+O2=CO2+H2O
C3H8+O2=CO2+H2O
Ca+H2O=CaOH+H2
CO2+OH=H20+CO3
Cs(s) + H2O(l) =CsOH(s) + H2(g)
Ca+H2O=CaOH+H2
Ca(ClO3)2=CaCl2+O2
Ca(ClO3)2=CaCl2+3O2
CuO + H3O+ = Cu(H2O)+2 + H2O

CuSO4 + KI = CuI + KSO4


3Cu + 8HNO3 = 3Cu(NO3)2 +
2NO + 4H2O
2CuSO4(aq) + 4KI(s) = 2CuI(s)
+ I2(s) + 2K2SO4(aq)
2C2H6 + 7O2 = 4CO2 + 6H2O
CaC2(s) + 2H2O(l) =
Ca(OH)2(s) + C2H2(g)
CaC2(s) + 2H2O(l) =
Ca(OH)2(s) + C2H2(g)
C2H5OH(l) + 3O2(g) =
2CO2(g) + 3H2O(l)
2C2H6 + 7O2 = 4CO2 + 6H2O
CO2 + OH = H + CO3
2CH3OH + 3O2 = 2CO2 +
4H2O
CaH2(s) + 2H2O(g) =
Ca(OH)2(s) + 2H2(g)
CaCO3 + 2HCl = H2O + CO2
+ CaCl2
2C6H14 + 19O2 = 12CO2 +
14H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
CaC2(s) + 2H2O(l) =
Ca(OH)2(s) + C2H2(g)
CH4 + CCl4 = 2CH2Cl2
CH4 + 2O2 = CO2 + 2H2O
CO2 + 2KOH = K2CO3 + H2O
CH4 + 2O2 = CO2 + 2H2O
2CO + O2 = 2CO2
6CO2 + 6H2O = C6H12O6 +
6O2
C6H12O6(aq) = 2C2H6O(aq) +
2CO2(g)
2C8H18 + 25O2 = 16CO2 +
18H2O
C3H8 + 5O2 = 3CO2 + 4H2O
2Ca + 2H2O = 2CaOH + H2
20CO2 + 20OH = H20 +
20CO3
2Cs(s) + 2H2O(l) = 2CsOH(s)
+ H2(g)
2Ca + 2H2O = 2CaOH + H2
Ca(ClO3)2 = CaCl2 + 3O2
Ca(ClO3)2 = CaCl2 + 3O2
CuO + 2H3O+ = Cu(H2O)+2 +
2H2O

CuO + 2H3O+ = Cu(H2O)+2 +


2H2O
Ca+S=CaS
Ca + S = CaS
Ca+S=CaS
Ca + S = CaS
-1CuO - 2H3O+ = CuO + H3O+ = Cu(H2O)6+2 + H2O
1Cu(H2O)6+2 + 3H2O
CuO + 2H3O+ = Cu(H2O)+2 +
CuO + H3O+ = Cu(H2O)+2 + H2O
2H2O
CuO + 2H3O+ = Cu(H2O)+2 +
CuO + H3O+ = Cu(H2O)+2 + H2O
2H2O
CH3COOH + NaHCO3 =
CH3COOH + NaHCO3 = NaCH3COO + CO2 + H2O
NaCH3COO + CO2 + H2O
2C6H6(l) + 15O2(g) =
C6H6(l) + O2(g) = CO2(g) + H2O(g)
12CO2(g) + 6H2O(g)
Cr(s) + S8(s) = Cr2S3(s)
16Cr(s) + 3S8(s) = 8Cr2S3(s)
CaO + 2NH4Cl = CaCl2 + H2O
CaO + NH4Cl = CaCl2 + H2O + NH3
+ 2NH3
CH4+Br2=CHBr3+HBr
CH4 + 3Br2 = CHBr3 + 3HBr
C3H4 + O2 = CO2 + H2O
C3H4 + 4O2 = 3CO2 + 2H2O
CH3CH2OH + O2 =
CH3CH2OH + O2 = CH3COOH + H2O
CH3COOH + H2O
CH3CH2OH + O2 =
CH3CH2OH + O2 = CH3COOH + H2O
CH3COOH + H2O
Ca+Br2=CaBr2
Ca + Br2 = CaBr2
C7H16(l) + O2(g)=C7H16O2
C7H16(l) + O2(g) = C7H16O2
CO+O2 = CO2
2CO + O2 = 2CO2
2Ca3(PO4)2(s) + 6SiO2(s) +
Ca3(PO4)2(s) + SiO2(s) + C(s) =CaSiO3(s) + CO(g) +
10C(s) = 6CaSiO3(s) +
P4(s)
10CO(g) + P4(s)
2CuSO4(aq) + 4KI(s) = 2CuI(s)
CuSO4(aq) + KI(s) =CuI(s) + I2(s) + K2SO4(aq)
+ I2(s) + 2K2SO4(aq)
CH4+O2=CO2+H2O
CH4 + 2O2 = CO2 + 2H2O
CaC2(s) + 2H2O(l) =
CaC2(s) + H2O(l) =Ca(OH)2(s) + C2H2(g)
Ca(OH)2(s) + C2H2(g)
C2H5OH(l) + 3O2(g) =
C2H5OH(l) + O2(g)= CO2(g) + H2O(l)
2CO2(g) + 3H2O(l)
2C2H4O2S + 7O2 = 4CO2 +
C2H4O2S + O2 = CO2 + H2O + SO3
4H2O + 2SO3
4C2H3N + 11O2 = 8CO +
C2H3N + O2 =CO +H2O + NO2
6H2O + 4NO2
CH3COOH(aq) + NaHSO3(aq)
CH3COOH (aq)+ NaHSO3(aq) = CH3COONa (aq) +
= CH3COONa(aq) + SO2(g) +
SO2 (g) + H2O (l)
H2O(l)
2C6H6(l) + 15O2(g) = 6H2O(g)
C6H6(l) + O2(g) = H2O(g) + CO2(g)
+ 12CO2(g)
CH4(g) + 2O2(g) = CO2(g) +
CH4(g)+O2(g)=CO2(g)+H2O(g)
2H2O(g)
CaCl2 + Na2CO3 = NaCl + CaCO3
CaCl2 + Na2CO3 = 2NaCl +
CuO + H3O+ = Cu(H2O)+2 + H2O

C3H6(g) + O2(g) = CO2(g) + H2O(l)


CaSO4+AlBr3=CaBr2+Al2(SO4)3
C3H8+O2=CO2+H2O
Ca+H2O=Ca(OH)+H2
C3H5(NO3)3=CO2+N2+H2O+O2
C2H6 + O2 = CO2 + H2O
CH4 + 2O2 = CO2 + 2H2O
Co(C2H3O2)2(aq) + Na2S(aq) =CoS(s) +
NaC2H3O2(aq)
Co(C2H3O2)2(aq) + Na2S(aq) =CoS(s) +
NaC2H3O2(aq)
C2H6+O2=CO2+H2O
CaCO3 = CaO + CO2
C8H18(g)+O2(g)=CO2(g)+H2O(g)
C3H8OS + O2 = CO2 + H2O + SO3
CuSO4 + KOH = K2SO4 + Cu(OH)2
CO2+ H2O = C6H12O6 + O2
Cu + H2SO4 = CuSO4 + H2
C2H4Cl2 + O2 = CO + H2O + Cl2
CH4 + Cl2 = CH2Cl2 + HCl
C8H18O3(l) + O2(g) = H2O(g) + CO2(g)
C6H6 + O2 = CO2 + H2O
Ce2(SO4)3 + H2O = Ce2O3 + H2(SO4)
C4H10 + 2 O2 = 3 CO2 + 4 H2O
C2H6 + O2=CO2 +H2O
C2H6O+O2=CO2+H2O
C4H10O+O2=CO2+H2O
C4H10+O2=CO2+H2O
C6H12+O2=CO2+H2O
C2H6 + O2 = CO2 + H2O
C5H12+O2=CO2+H2O
C5H8+O2=CO2+H2O

CaCO3
2C3H6(g) + 9O2(g) = 6CO2(g)
+ 6H2O(l)
3CaSO4 + 2AlBr3 = 3CaBr2 +
Al2(SO4)3
C3H8 + 5O2 = 3CO2 + 4H2O
2Ca + 2H2O = 2Ca(OH) + H2
4C3H5(NO3)3 = 12CO2 + 6N2
+ 10H2O + O2
2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 + 2O2 = CO2 + 2H2O
Co(C2H3O2)2(aq) + Na2S(aq)
= CoS(s) + 2NaC2H3O2(aq)
Co(C2H3O2)2(aq) + Na2S(aq)
= CoS(s) + 2NaC2H3O2(aq)
2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 = CaO + CO2
2C8H18(g) + 25O2(g) =
16CO2(g) + 18H2O(g)
C3H8OS + 6O2 = 3CO2 +
4H2O + SO3
CuSO4 + 2KOH = K2SO4 +
Cu(OH)2
6CO2 + 6H2O = C6H12O6 +
6O2
Cu + H2SO4 = CuSO4 + H2
C2H4Cl2 + 2O2 = 2CO +
2H2O + Cl2
CH4 + 2Cl2 = CH2Cl2 + 2HCl
C8H18O3(l) + 11O2(g) =
9H2O(g) + 8CO2(g)
2C6H6 + 15O2 = 12CO2 +
6H2O
Ce2(SO4)3 + 3H2O = Ce2O3
+ 3H2(SO4)
2C4H10 + 13O2 = 8CO2 +
10H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6O + 3O2 = 2CO2 + 3H2O
C4H10O + 6O2 = 4CO2 +
5H2O
2C4H10 + 13O2 = 8CO2 +
10H2O
C6H12 + 9O2 = 6CO2 + 6H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
C5H12 + 8O2 = 5CO2 + 6H2O
C5H8 + 7O2 = 5CO2 + 4H2O

CaCN2 + H2O = CaCO3 + NH3


CO(NH2)2+H2=2NH3+CO
CH4+O2 = CO2+ H2O
C2H6+O2=CO2+H2O
Cr(aq) + NaOH(aq) = CrOH + Na
CaCO3+HCl=H2O+CO2+CaCl2
C6H14 + O2 = CO2 + H2O
C2H6 + O2 = CO2 + H2O
CaC 2+ H 2O = HCCH+ Ca(OH) 2
CuCO3=CuO+ CO2
C 6H 5Cl+ O 2 = CO+ H 2O+ HCl
C2H4Cl2 + O2 = CO2 + H2O + HCl
C7H16 = C6H12 + H2
C6H12O2 + O2=CO2 + H2O
CaCl2(aq)+2NaNO3(aq)=2NaCl+Ca(NO3)2
Cd(NO3)2+Na3PO4=Cd3(PO4)2+Na(NO3)
C2H8N2+2N2O4=2N2+2CO2+4H2O
CH4O + O2 = CO2 + H2O
CaH2 + H2O = Ca(OH)2 + H2
C8H18 + O2 =CO2 + H2O
C8H18+O2 = CO + H2O
Ca(OH)2+Fe(ClO4)3=Fe(OH)3+Ca(ClO4)2
C5H12 + O2 = CO2 + H2O
CH3OH + O2 = CO2 + H2O
CH4+O2=CO2+H2O
Ca + O2 = CaO
C2H8N2 + N2O4 = N2 + CO2 + H2O
Cu+HCl= CuCl+H
C2H6O + O2 = C2H4O2 + H2O

CaCN2 + 3H2O = CaCO3 +


2NH3
CO(NH2)2 + H2 = 2NH3 + CO
CH4 + 2O2 = CO2 + 2H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
Cr(aq) + NaOH(aq) = CrOH +
Na
CaCO3 + 2HCl = H2O + CO2
+ CaCl2
2C6H14 + 19O2 = 12CO2 +
14H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
CaC2 + 2H2O = HCCH +
Ca(OH)2
CuCO3 = CuO + CO2
C6H5Cl + 4O2 = 6CO + 2H2O
+ HCl
2C2H4Cl2 + 5O2 = 4CO2 +
2H2O + 4HCl
6C7H16 = 7C6H12 + 6H2
C6H12O2 + 8O2 = 6CO2 +
6H2O
CaCl2(aq) + 2NaNO3(aq) =
2NaCl + Ca(NO3)2
3Cd(NO3)2 + 2Na3PO4 =
Cd3(PO4)2 + 6Na(NO3)
C2H8N2 + 2N2O4 = 3N2 +
2CO2 + 4H2O
2CH4O + 3O2 = 2CO2 + 4H2O
CaH2 + 2H2O = Ca(OH)2 +
2H2
2C8H18 + 25O2 = 16CO2 +
18H2O
2C8H18 + 17O2 = 16CO +
18H2O
3Ca(OH)2 + 2Fe(ClO4)3 =
2Fe(OH)3 + 3Ca(ClO4)2
C5H12 + 8O2 = 5CO2 + 6H2O
2CH3OH + 3O2 = 2CO2 +
4H2O
CH4 + 2O2 = CO2 + 2H2O
2Ca + O2 = 2CaO
C2H8N2 + 2N2O4 = 3N2 +
2CO2 + 4H2O
Cu + HCl = CuCl + H
C2H6O + O2 = C2H4O2 +
H2O

C2H6O + O2 = CO2 + H2O


C2H6 + O2 = CO2 + H2O

C2H6O + 3O2 = 2CO2 + 3H2O


2C2H6 + 7O2 = 4CO2 + 6H2O
CuSO4 + 2HCl = H2SO4 + Cu
CuSO4 + HCl = H2SO4 + Cu +Cl2
+ Cl2
2CH3CH2OH(l) + O2(g) =
CH3CH2OH(l)+O2(g)=CH3CHO(aq)+H2O(l)
2CH3CHO(aq) + 2H2O(l)
2C4H10 + 13O2 = 8CO2 +
C4H10+O2=CO2+H2O
10H2O
Co2O3 + C = Co + CO2
2Co2O3 + 3C = 4Co + 3CO2
C6H5CH3 + 9O2 = 7CO2 +
C6H5CH3+O2=CO2+H2O
4H2O
2C6H14 + 19O2 = 12CO2 +
C6H14+O2=CO2+H2O
14H2O
Ca(OH)2 + 2HCl = CaCl2 +
Ca(OH)2 + HCl = CaCl2 + H2O
2H2O
C9H20 + 14O2 = 9CO2 +
C9H20+O2=CO2+H2O
10H2O
Cr2O7-- + 6Fe++ + 14H+ =
Cr2O7-- + Fe++ + H+ = Cr+++ + Fe+++ + H2O
2Cr+++ + 6Fe+++ + 7H2O
Cr2O7-- + CH3CH2OH + H+ = Cr+++ + CH3CHO +
Cr2O7-- + 3CH3CH2OH + 8H+
H2O
= 2Cr+++ + 3CH3CHO + 7H2O
CH4+O2=CO2+H2O
CH4 + 2O2 = CO2 + 2H2O
2C2H4Cl2 + 5O2 = 4CO2 +
C2H4Cl2 + O2 = CO2 + H2O +HCl
2H2O + 4HCl
4C12H22011 + 22059O2 =
C12H22011+O2=CO2+H2O
48CO2 + 44022H2O
Cu + 2H2SO4 = CuSO4 + SO2
Cu + H2SO4 = CuSO4 + SO2 + H2O
+ 2H2O
4C12H22011 + 22059O2 =
C12H22011 + O2 = CO2 + H2O
48CO2 + 44022H2O
CuSO4(aq) + Zn(s) = Cu(s) +
CuSO4(aq)+Zn(s) =Cu(s) = ZnSO4 (aq)
ZnSO4(aq)
8Co(NO3)2 + 22NH3 +
Co(NO3)2 + NH3 + (NH4)2CO3 = (Co(NH3)4CO3)NO3 8(NH4)2CO3 =
+ NH4NO3 + 2H2O
8(Co(NH3)4CO3)NO3 +
7NH4NO3 + 3H2O
C5H6O + O2 = CO2 + H2O
C5H6O + 6O2 = 5CO2 + 3H2O
6CO2 + 6H2O = C6H12O6 +
CO2 + 6H2O = C6H12O6 + O2
6O2
C4H10 + O2 = CO2 + H20
2C4H10 + 8O2 = 8CO2 + H20
C4H10 + O2 = CO2 + 5H20
2C4H10 + 8O2 = 8CO2 + H20
Cu2O + SO2 = Cu2SO3
Cu2O + SO2 = Cu2SO3
CS + Cl2 = CCl4 + S2 Cl2
2CS + 5Cl2 = 2CCl4 + S2Cl2
Ca(s)+Br2(l)=CaBr2(s)
Ca(s) + Br2(l) = CaBr2(s)
3Cu(s) + FeCl3 = 3CuCl +
Cu(s)+FeCl3=CuCl+Fe(s)
Fe(s)
CO+O2=CO2
2CO + O2 = 2CO2

C6H10O5 + O2 =CO2 + H2O


CH4 +Cl2 =HCl + C
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O
Ca3P2 + H2O = Ca(OH)2 + PH3
CH3OH + ClO3 = CO2 + H2O + ClO2
CH3OH + ClO3 = CO2 + H2O + ClO2
C6H6(l)+O2(g)=CO(g)+H2O(g)
CCl4 + HF = CCl2F2 + HCl
CCl4 + HF = CCl2F2 + HCl
C4H10(g)+O2(g)=CO2(g)+H2O(g)
C3H8+O2=CO2+H2O
C + S8 = CS2
Ca(OH)2+H(NO3)=Ca(NO3)2+H(OH)
C12H22O11+O2=CO2+H2O
C12H22O11+O2=CO2+H2O
Ca(OH)2 + NH4Cl = CaCl2 + NH3 + H2O
C8H18+O2=CO2+H2O
Ca(OH)2 + CO2 = CaCO3 + H2O
CH4+Cl2 = CCl4+HCl
C2H6O+O2=CO2+H2O
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2O
Ca(NO3)2 + K3PO4 = 3KNO3 + Ca3(PO4)2
Cu(OH)2=CuO+H2O
Cu(NO3)2+NaOH=Cu(OH)2+NaNO3
Cu+HNO3=Cu(NO3)2+NO2+H2O
CuSO4+CaSi2=CaSO4+Cu+Si

C6H10O5 + 6O2 = 6CO2 +


5H2O
CH4 + 2Cl2 = 4HCl + C
3Ca(OH)2 + 2H3PO4 =
Ca3(PO4)2 + 6H2O
3Ca(OH)2 + 2H3PO4 =
Ca3(PO4)2 + 6H2O
3Ca(OH)2 + 2H3PO4 =
Ca3(PO4)2 + 6H2O
Ca3P2 + 6H2O = 3Ca(OH)2 +
2PH3
CH3OH + 3ClO3 = CO2 +
2H2O + 3ClO2
CH3OH + 3ClO3 = CO2 +
2H2O + 3ClO2
2C6H6(l) + 9O2(g) = 12CO(g)
+ 6H2O(g)
CCl4 + 2HF = CCl2F2 + 2HCl
CCl4 + 2HF = CCl2F2 + 2HCl
2C4H10(g) + 13O2(g) =
8CO2(g) + 10H2O(g)
C3H8 + 5O2 = 3CO2 + 4H2O
4C + S8 = 4CS2
Ca(OH)2 + 2H(NO3) =
Ca(NO3)2 + 2H(OH)
C12H22O11 + 12O2 = 12CO2
+ 11H2O
C12H22O11 + 12O2 = 12CO2
+ 11H2O
Ca(OH)2 + 2NH4Cl = CaCl2 +
2NH3 + 2H2O
2C8H18 + 25O2 = 16CO2 +
18H2O
Ca(OH)2 + CO2 = CaCO3 +
H2O
CH4 + 4Cl2 = CCl4 + 4HCl
C2H6O + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + 2HNO3 =
Ca(NO3)2 + 2H2O
3Ca(NO3)2 + 2K3PO4 =
6KNO3 + Ca3(PO4)2
Cu(OH)2 = CuO + H2O
Cu(NO3)2 + 2NaOH =
Cu(OH)2 + 2NaNO3
Cu + 4HNO3 = Cu(NO3)2 +
2NO2 + 2H2O
CuSO4 + CaSi2 = CaSO4 +
Cu + 2Si

Cu + 4HNO3 = Cu(NO3)2 +
2NO2 + 2H2O
Cu + 4HNO3 = Cu(NO3)2 +
Cu+HNO3=Cu(NO3)2+NO2+H2O
2NO2 + 2H2O
CaCO3 + 2HCl = CaCl2 + CO2
CaCO3 + HCl = CaCl2 + CO2 +H2O
+ H2O
2Cu(NO3)2 + 8NH3 =
Cu(NO3)2 + NH3 = (Cu(NH3)4) 2 + NO3
(Cu(NH3)4)2 + 4NO3
3C3H6 + 2KMnO4 + 4H2O =
C3H6 + KMnO4 + H2O = C3H8O2 + MnO2 + KOH
3C3H8O2 + 2MnO2 + 2KOH
2CrI3 + 64KOH + 27Cl2 =
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O
2K2CrO4 + 6KIO4 + 54KCl +
32H2O
2CrCl3 + 3Na2O2 + 4NaOH =
CrCl3 + Na2O2 + NaOH = Na2CrO4 + NaCl + H2O
2Na2CrO4 + 6NaCl + 2H2O
Cu(OH)2 + 2HCl = CuCl2 +
Cu(OH)2+HCl=CuCl2+H2O
2H2O
CO2 + O2 = CO2
CO2 + 0O2 = CO2
CaCO3 + 2HCl = Ca(Cl)2 +
CaCO3 + HCl = Ca(Cl)2 + CO2 + H2O
CO2 + H2O
Ca + 4HNO3 = Ca(NO3)2 +
Ca+HNO3 = Ca(NO3)2+H2O+NO2
2H2O + 2NO2
CH4 + Cl2 = CH2Cl2 + HCl
CH4 + 2Cl2 = CH2Cl2 + 2HCl
CH4 + Cl2 = CH2Cl2 + HCl
CH4 + 2Cl2 = CH2Cl2 + 2HCl
CaCO3 = CO2 + CaO
CaCO3 = CO2 + CaO
CH4 + O2 = CO2+H2O
CH4 + 2O2 = CO2 + 2H2O
Ca(OH)2 + 2HCl = CaCl2 +
Ca(OH)2+HCl=CaCl2+H(OH)
2H(OH)
Cl2+Li=LiCl
Cl2 + 2Li = 2LiCl
Cu + 2Ag(NO3) = Cu(NO3)2 +
Cu+Ag(NO3)=Cu(NO3)2+Ag
2Ag
CO2+Na2O=Na2(CO3)
CO2 + Na2O = Na2(CO3)
CaO+H2O=Ca(OH)2
CaO + H2O = Ca(OH)2
CO2+H2O=H2CO3
CO2 + H2O = H2CO3
Ca(C2H3O2)2+(NH4)2(CO3)=Ca(CO3)+(NH4)(C2H3O Ca(C2H3O2)2 + (NH4)2(CO3)
2)
= Ca(CO3) + 2(NH4)(C2H3O2)
Cu(SO4) + Na2S = Na2(SO4)
Cu(SO4)+Na2S=Na2(SO4)=CuS
+ CuS
Cl2+NaBr=NaCl+Br2
Cl2 + 2NaBr = 2NaCl + Br2
Ca+H(OH)=Ca(OH)2+H2
Ca + 2H(OH) = Ca(OH)2 + H2
CaO+HCl=CaCl2+H2O
CaO + 2HCl = CaCl2 + H2O
Ca(AlO2)2 + 8HCl = CaCl2 +
Ca(AlO2)2+HCl=CaCl2+AlCl3+H2O
2AlCl3 + 4H2O
Ca + H2O = H2 + Ca(OH)2
Ca + 2H2O = H2 + Ca(OH)2
CH4 + O2 = CO2 + H2O
CH4 + 2O2 = CO2 + 2H2O
2C9H18O6 + 21O2 = 18CO2 +
C9H18O6+O2=CO2+H2O
18H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2O

C2H6O+O2=CO2+H2O
C9H20+O2=CO2+H2O
Ca(NO3)2= Ca+NO3
Cu+Ag(NO3)=Cu(NO3)2+Ag
C2H5OH(g) + O2(g) = CO2(g) + H2O
Ca(OH)2 + SO2 + O2 = CaSO4 + H2O
C6H8O6 + NaOH = C6H9O7 + Na
C6H6+O2= CO2+H2O
CS2(l)+O2(g)=2S(g)+CO2(g)
Cu + 8HNO3 = Cu(NO3)2 + NO + H2O
Cu + 8HNO3 = 3Cu(NO3)2 + NO + 4H2O
CoCl2 + 2HF = CoF2 + 2HCl
CaSiO3 + HF = CaF2 + SiF4 + H2O
CaCO3 + HNO3 = Ca(NO3)2 + H2O + CO2
C12H22O11 + O2 = CO2 + H2O
C4H10 + O2 = CO2 + H2O
C6H6 + O2 = CO2 + H2O
CaO + C = CaC2 + CO2
C5H12O + O2 = CO2 + H2O
C6H6 + O2 = 3H2O + 6CO2
C2H6+O2=CO2+H2O
C2H6+O2=CO2+H20
Cr + HBr + O2 = CrBr3 + H2O
Cu + H2SO4 = CuSO4 + SO2 + H2O
CO2+H=CH4 +H2O
C2H2(g) + O2(g) = CO2(g) + H2O(g)
Ca(OH)2(aq) + HCl(aq) = CaCl2(aq) + HOH

C2H6O + 3O2 = 2CO2 + 3H2O


C9H20 + 14O2 = 9CO2 +
10H2O
Ca(NO3)2 = Ca + 2NO3
Cu + 2Ag(NO3) = Cu(NO3)2 +
2Ag
C2H5OH(g) + 3O2(g) =
2CO2(g) + 3H2O
2Ca(OH)2 + 2SO2 + O2 =
2CaSO4 + 2H2O
C6H8O6 + NaOH = C6H9O7 +
Na
2C6H6 + 15O2 = 12CO2 +
6H2O
CS2(l) + O2(g) = 2S(g) +
CO2(g)
3Cu + 8HNO3 = 3Cu(NO3)2 +
2NO + 4H2O
3Cu + 8HNO3 = 3Cu(NO3)2 +
2NO + 4H2O
CoCl2 + 2HF = CoF2 + 2HCl
CaSiO3 + 6HF = CaF2 + SiF4
+ 3H2O
CaCO3 + 2HNO3 = Ca(NO3)2
+ H2O + CO2
C12H22O11 + 12O2 = 12CO2
+ 11H2O
2C4H10 + 13O2 = 8CO2 +
10H2O
2C6H6 + 15O2 = 12CO2 +
6H2O
2CaO + 5C = 2CaC2 + CO2
2C5H12O + 15O2 = 10CO2 +
12H2O
2C6H6 + 15O2 = 6H2O +
12CO2
2C2H6 + 7O2 = 4CO2 + 6H2O
10C2H6 + 20O2 = 20CO2 +
3H20
4Cr + 12HBr + 3O2 = 4CrBr3 +
6H2O
Cu + 2H2SO4 = CuSO4 + SO2
+ 2H2O
CO2 + 8H = CH4 + 2H2O
2C2H2(g) + 5O2(g) = 4CO2(g)
+ 2H2O(g)
Ca(OH)2(aq) + 2HCl(aq) =
CaCl2(aq) + 2HOH

C3H5N3O9=CO2+H20+N2+O2
C4H8+O2=CO2+H2O
C2O4 + MnO2 = Mn2 + CO2
Cu(OH)2 = CuO + H2O
C3H6+O2=H2O+CO2
C6H12O6 + O2 = C2H6O + CO2
C5H12+5O2=5CO2+5H2O
CO2+C2H5OH=C6H12O6
C6H12O6 + O2 = C2H6O + CO2
C2H2+O2=CO2+H2O
C2H6 + O2=CO2 + H2O
C2 H6 + O2=CO2 + H2O
C2H6+O2=CO2+H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)
C4H10O(l)+O2(g)=CO2+H2O
C4H10O(l)+O2(g)=CO2+H2O
C8H18+O2=CO2+H20
C2H6 + O2= CO2 + H2O
CH4 + O2 = CO2 +H2O
C3H8 + O2 = CO2 + H2O
C3H8(g)+O2(g)=CO2(g)+H2O(g)
CH3CH2OH + O2 = CO2 + H2O
Cu + H(NO3) = Cu(NO3)2 + NO + H2O
C5H10+O2=CO2+H20
Cu2O + C = Cu + CO
C2H5OH(g) + O2(g) =CO2(g) + H2O(l)
C6H14+O2=CO2+H20
CO2 + P3 = PCO2
Cl2+NaBr=NaCl + Br
CaCO3=CaO+CO2
Cu + H(NO3) = Cu(NO3)2 + NO + H2O

4C3H5N3O9 = 12CO2 + H20 +


6N2 + 6O2
C4H8 + 6O2 = 4CO2 + 4H2O
C2O4 + 0MnO2 = 0Mn2 +
2CO2
Cu(OH)2 = CuO + H2O
2C3H6 + 9O2 = 6H2O + 6CO2
C6H12O6 + 0O2 = 2C2H6O +
2CO2
C5H12 + 8O2 = 5CO2 + 6H2O
2CO2 + 2C2H5OH =
C6H12O6
C6H12O6 + 0O2 = 2C2H6O +
2CO2
2C2H2 + 5O2 = 4CO2 + 2H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
2CO2(g) + CaSiO3(s) + H2O(l)
= SiO2(s) + Ca(HCO3)2(aq)
C4H10O(l) + 6O2(g) = 4CO2 +
5H2O
C4H10O(l) + 6O2(g) = 4CO2 +
5H2O
10C8H18 + 80O2 = 80CO2 +
9H20
2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 + 2O2 = CO2 + 2H2O
C3H8 + 5O2 = 3CO2 + 4H2O
C3H8(g) + 5O2(g) = 3CO2(g) +
4H2O(g)
CH3CH2OH + 3O2 = 2CO2 +
3H2O
3Cu + 8H(NO3) = 3Cu(NO3)2
+ 2NO + 4H2O
2C5H10 + 10O2 = 10CO2 +
H20
Cu2O + C = 2Cu + CO
C2H5OH(g) + 3O2(g) =
2CO2(g) + 3H2O(l)
10C6H14 + 60O2 = 60CO2 +
7H20
3CO2 + P3 = 3PCO2
Cl2 + 2NaBr = 2NaCl + 2Br
CaCO3 = CaO + CO2
3Cu + 8H(NO3) = 3Cu(NO3)2
+ 2NO + 4H2O

C+O=CO2
CH3OH + O2 = CO2 + H2O
C2H6+O2=CO2+H20
C2H6+O2=4CO2+H20
C + O2 = CO2
CH3OH+O2=CO2+H2O
C4H10O+6O2=4CO2+5H2O
CO2 + H2 = CH4 + H2O
CH3OH(l)+O2(g)=CO2+H2O
C4H10O+O2=CO2+H2O
Cl + AgNO3 = AgCl + NO3
Ca + (NH4)2CO3 = CaCO3 + NH4
C4H10+O2=CO2+H2O
CaOH + HNO3 = CaNO3 +H2O
Cu(NO3)2 + NaOH = Cu(OH)2 + Na(NO3)
Ca+AgNO3=2Ag+Ca(NO3)2
Cu + HNO3 = Cu(NO3)2 + NO2 + H2O
Ca (s) +HNO3 (aq)=Ca(NO3)2+2N2O+H2O
CO + O2= CO2
C6H14 + O2 = CO2 + H2O
C6H14 + O2 = CO2 + H20
C6H12 + O2 = CO2 + H20
C2H6+O2=CO2+H2O
C5H10O + O2 = 5CO2 + H2O
C6H14 + O2 = CO2 + H2O
CaS(aq)+Cr(NO3)3(aq)=Ca(NO3)3(aq)+SCr
C5H12(g) + O2(g) = CO2(g) + H2O(g)

C + 2O = CO2
2CH3OH + 3O2 = 2CO2 +
4H2O
10C2H6 + 20O2 = 20CO2 +
3H20
10C2H6 + 20O2 = 20CO2 +
3H20
C + O2 = CO2
2CH3OH + 3O2 = 2CO2 +
4H2O
C4H10O + 6O2 = 4CO2 +
5H2O
CO2 + 4H2 = CH4 + 2H2O
2CH3OH(l) + 3O2(g) = 2CO2 +
4H2O
C4H10O + 6O2 = 4CO2 +
5H2O
Cl + AgNO3 = AgCl + NO3
Ca + (NH4)2CO3 = CaCO3 +
2NH4
2C4H10 + 13O2 = 8CO2 +
10H2O
CaOH + HNO3 = CaNO3 +
H2O
Cu(NO3)2 + 2NaOH =
Cu(OH)2 + 2Na(NO3)
Ca + 2AgNO3 = 2Ag +
Ca(NO3)2
Cu + 4HNO3 = Cu(NO3)2 +
2NO2 + 2H2O
4Ca(s) + 10HNO3(aq) =
4Ca(NO3)2 + N2O + 5H2O
2CO + O2 = 2CO2
2C6H14 + 19O2 = 12CO2 +
14H2O
10C6H14 + 60O2 = 60CO2 +
7H20
5C6H12 + 30O2 = 30CO2 +
3H20
2C2H6 + 7O2 = 4CO2 + 6H2O
C5H10O + 7O2 = 5CO2 +
5H2O
2C6H14 + 19O2 = 12CO2 +
14H2O
CaS(aq) + Cr(NO3)3(aq) =
Ca(NO3)3(aq) + SCr
C5H12(g) + 8O2(g) = 5CO2(g)
+ 6H2O(g)

C7H16+O2=CO2+H2O
C2H6 + O2 = CO2 + H2O
CH4(g) + H2O(g) = CO(g) + H2(g)
CH4(g) + O2(g) = CO2(g) + H2O(g)
Cu + Cu(NH3)4Cl2 + NH4OH = H2O + Cu(NH3)Cl
CH3CH2OH +O2 = CO2 + H2O
Cl2+KI = KCl +I2
CaCl2 + Na3PO4 = Ca3(PO4)2 + NaCl
Cu(NO3)2 + KCO3 = CuCO3 + K(NO3)2
Ca(s)+Br2(l)=CaBr2(s)
C6H4Cl2 + O2 = CO2 + H2O + Cl2
Cu(SO4) + Zn = ZnSO4 + Cu
C3N3(NH2)3 + CO2 = HNCO
C8H18 + O2 = CO2 + H2O
C3H5N3O9(l) = CO2(g) + H2O(g) + N2(g) + O2(g)
C8H18 + O2 = CO2+H2O
C2H6O+ O2= CO2+ H2O
Ca(s)+Br2(l)=CaBr2(s)
Cu + S = Cu2S
Cu + S = Cu2S
Cu + S = CuS
CaCO3 + HCl = CaCl2 + H2CO3
CaCl2+ Na3PO4= Ca3(PO4)2+ NaCl
C6H12O6 + O2 = CO2 + H2O
CuSO4 + NaOH = Cu(OH) + NaSO4
Ca+O2+C=CaCO3
Ca + HCl = CaCl + H2
C8H18(g)+O2(g)=CO2(g)+H2O(g)
C6H10 + O2 = CO2 + H2O

C7H16 + 11O2 = 7CO2 +


8H2O
2C2H6 + 7O2 = 4CO2 + 6H2O
CH4(g) + H2O(g) = CO(g) +
3H2(g)
CH4(g) + 2O2(g) = CO2(g) +
2H2O(g)
Cu + Cu(NH3)4Cl2 - 2NH4OH
= -2H2O + 2Cu(NH3)Cl
CH3CH2OH + 3O2 = 2CO2 +
3H2O
Cl2 + 2KI = 2KCl + I2
3CaCl2 + 2Na3PO4 =
Ca3(PO4)2 + 6NaCl
Cu(NO3)2 + KCO3 = CuCO3 +
K(NO3)2
Ca(s) + Br2(l) = CaBr2(s)
C6H4Cl2 + 7O2 = 6CO2 +
2H2O + Cl2
Cu(SO4) + Zn = ZnSO4 + Cu
C3N3(NH2)3 + 3CO2 =
6HNCO
2C8H18 + 25O2 = 16CO2 +
18H2O
4C3H5N3O9(l) = 12CO2(g) +
10H2O(g) + 6N2(g) + O2(g)
2C8H18 + 25O2 = 16CO2 +
18H2O
C2H6O + 3O2 = 2CO2 + 3H2O
Ca(s) + Br2(l) = CaBr2(s)
2Cu + S = Cu2S
2Cu + S = Cu2S
Cu + S = CuS
CaCO3 + 2HCl = CaCl2 +
H2CO3
3CaCl2 + 2Na3PO4 =
Ca3(PO4)2 + 6NaCl
C6H12O6 + 6O2 = 6CO2 +
6H2O
CuSO4 + NaOH = Cu(OH) +
NaSO4
2Ca + 3O2 + 2C = 2CaCO3
2Ca + 2HCl = 2CaCl + H2
2C8H18(g) + 25O2(g) =
16CO2(g) + 18H2O(g)
2C6H10 + 17O2 = 12CO2 +
10H2O

2C5H10O2 + 13O2 = 10CO2 +


10H2O
C12H24 + 18O2 = 12CO2 +
C12H24 + O2 = CO2 + H2O
12H2O
2C6H6 + 15O2 = 12CO2 +
C6H6 +O2 = CO2 + H2O
6H2O
C12H22O11 + 12O2 = 12CO2
C12H22O11 + O2 = CO2 + H2O
+ 11H2O
Co3(PO4)2 + 3Ca(C2H3O2)2
Co3(PO4)2+Ca(C2H3O2)2=Co(C2H3O2)2+Ca3(PO4)2 = 3Co(C2H3O2)2 +
Ca3(PO4)2
Ca3(PO4)2 + 3H2SO4 =
Ca3(PO4)2 + H2SO4 = H3PO4 +CaSO4
2H3PO4 + 3CaSO4
Cr(NO2)2 + (NH4)2SO4 =
Cr(NO2)2 + (NH4)2SO4 = CrSO4 + NH4NO2
CrSO4 + 2NH4NO2
2CH3OH + 3O2 = 2CO2 +
CH3OH + O2 = CO2 + H2O
4H2O
C2H6O+O2=CO2+H2O
C2H6O + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + 2HNO3 =
Ca(OH)2+HNO3= Ca(NO3)2+H2O
Ca(NO3)2 + 2H2O
Cl2 + NaI = NaCl2 + I
Cl2 + NaI = NaCl2 + I
CH4 +Cl2= CCl4+HCl
CH4 + 4Cl2 = CCl4 + 4HCl
Ca3(PO4)2 + 8C = Ca3P2 +
Ca3(PO4)2 + C = Ca3P2 + CO
8CO
Ca(OH)2 + H3PO4 = CaHPO4
Ca(OH)2 + H3PO4 = CaHPO4 + H2O
+ 2H2O
6CaC2 + 12H2O = (HC)6(CH)6
CaC2+H2O=(HC)6(CH)6+Ca(OH)2
+ 6Ca(OH)2
2C6H14 + 19O2 = 12CO2 +
C6H14+O2=CO2+H2O
14H2O
CaC2 + 2H2O = HCCH +
CaC2+ H2O=HCCH+Ca(OH)2
Ca(OH)2
CaC2 + 2H2O = HCCH +
CaC2+ H2O=HCCH+Ca(OH) 2
Ca(OH)2
3Cu + Zn3So4 = Cu3So4 +
Cu+Zn3So4=Cu3So4+Zn
3Zn
2C2H4Cl2 + 5O2 = 4CO2 +
C2H4Cl2+O2=CO2+H2O+HCl
2H2O + 4HCl
2C6H6 + 15O2 = 12CO2 +
C6H6 + O2 = CO2 + H2O
6H2O
2C7H16 + 15O2 = 14CO +
C7H16+O2=CO+H2O
16H2O
4CH3NH2 + 13O2 = 4CO2 +
CH3NH2+O2=CO2+H2O+NO2
10H2O + 4NO2
2C6H14 + 19O2 = 12CO2 +
C6H14+O2=CO2+H2O
14H2O
Co(C2H3O2) + NaS = CoS +
Co(C2H3O2) + NaS = CoS + Na(C2H3O2)
Na(C2H3O2)
C5H10O2+O2=CO2+H2O

Cr(NO3)2+Na3(PO4)=Cr3(PO4)2+Na(NO3)
CaCl2+K3AsO4=Ca3(AsO4)2+KCl
C12H22O11+O2=CO2+H2O
CuSO4 (aq) + KOH (aq) = CuOH (s) + KSO4(aq)
C2H5OH(l)+O2(g) =2CO2(g)+H2O(g)
C6H6(l) + O2(g) =CO2(g) + H2O(g)
CH3OH+O2=CO2+H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O
Cu(NO3) + NaOH = Cu(OH) + NaNO3
C4H10 + O2 = H2O + CO2
Cu + AgNO3 = Cu(NO3)2 + Ag
C6H12O6=2C2H5OH+CO2
Ca(OH)2 + H2SO4 = HOH + CaSO4
Ca(OH)2+ HCl=CaCl2+H2O
C6H12 + O2 = CO2 + H2O
C5H12 + O2 = CO2 + H2O
Cu + AgNO3 = Ag2Cu + NO3
Ca + H2SO4 = H2 + CaSO4
CH3OH + ClO3 = ClO2 + H2O + CO2
Cu + MgCl2 = CuCl2 + Mg
CO+SO2 = S+ CO2

3Cr(NO3)2 + 2Na3(PO4) =
Cr3(PO4)2 + 6Na(NO3)
3CaCl2 + 2K3AsO4 =
Ca3(AsO4)2 + 6KCl
C12H22O11 + 12O2 = 12CO2
+ 11H2O
CuSO4(aq) + KOH(aq) =
CuOH(s) + KSO4(aq)
C2H5OH(l) + 3O2(g) =
2CO2(g) + 3H2O(g)
2C6H6(l) + 15O2(g) =
12CO2(g) + 6H2O(g)
2CH3OH + 3O2 = 2CO2 +
4H2O
3Cu + 8HNO3 = 3Cu(NO3)2 +
2NO + 4H2O
Cu(NO3) + NaOH = Cu(OH) +
NaNO3
2C4H10 + 13O2 = 10H2O +
8CO2
Cu + 2AgNO3 = Cu(NO3)2 +
2Ag
C6H12O6 = 2C2H5OH +
2CO2
Ca(OH)2 + H2SO4 = 2HOH +
CaSO4
Ca(OH)2 + 2HCl = CaCl2 +
2H2O
C6H12 + 9O2 = 6CO2 + 6H2O
C5H12 + 8O2 = 5CO2 + 6H2O
Cu + 2AgNO3 = Ag2Cu +
2NO3
Ca + H2SO4 = H2 + CaSO4
CH3OH + 3ClO3 = 3ClO2 +
2H2O + CO2
Cu + MgCl2 = CuCl2 + Mg
2CO + SO2 = S + 2CO2