LONG QUIZ NO.

1-FINAL PERIOD
GENERAL CHEMISTRY

Multiple Choice
Identify the choice that best completes the statement or answers the question.
____ 1. Which of the following best describes the rates of chemical reaction?
a. most chemical reactions occur very slowly
b. most chemical reactions occur at moderate rates
c. most chemical reactions occur very rapidly
d. chemical reactions have a wide range of rates, from extremely fast to extremely slow
____ 2. Which of the following is the study of the rates of chemical reactions?
a. kinetics b. stoichiometry c. thermodynamics d. none of these
____ 3. For the reaction 2C A + B which of the following is true?
a. A is produced at twice the rate C is consumed
b. A is produced at the same rate C is consumed
c. A is produced at half the rate that C is consumed
d. none of the above
____ 4. For the reaction 2C A + B which of the following is true?
a. A is produced at twice the rate C is consumed
b. A is produced at the same rate C is consumed
c. A is produced at the same rate that B is produced
d. none of the above
____ 5. For the reaction A + B 2C, 0.01 mole of A is consumed during the first 15 seconds of the reaction.
Assuming that the rate of reaction remains constant for two minutes, which of the following statements is
true?
a. after 2 minutes 0.08 moles of B were consumed
b. after 2 minutes 0.08 moles of C were produced
c. both (a) and (b) are true
d. both (a) and (b) are false
____ 6. For the reaction A + B 2C, 0.01 mole of C is produced during the first 15 seconds of the reaction.
Assuming that the rate of reaction remains constant for two minutes, which of the following statements is
true?
a. after 2 minutes 0.04 moles of A were consumed
b. after 2 minutes 0.08 moles of B were consumed
c. both (a) and (b) are true
d. both (a) and (b) are false
____ 7. For the reaction A + B 2C, 0.01 mole of A is consumed during the first 15 seconds of the reaction.
Assuming that the rate of reaction remains constant for two minutes, which of the following statements is
true?
a. after 2 minutes 0.08 moles of B were consumed
b. after 2 minutes 0.16 moles of C were produced
c. both (a) and (b) are true
d. both (a) and (b) are false
____ 8. Which of the following is true of the rates of most chemical reactions?
a. the initial rate is cannot be measured
b. the initial rate is faster than the rate later in time
c. the initial rate is the same as the rate later in time
 d. the initial rate is slower than the rate later in time
____ 9. Which of the following is true of effective collisions?
a. the number of effective collisions decreases as the temperature is increased
b. the number of effective collisions determines the reaction rate
c. both (a) and (b)
d. neither (a) nor (b)
____ 10. Which of the following is true of effective collisions?
a. the number of effective collisions determines the reaction rate
b. the number of effective collisions increases as the temperature is increased
c. both (a) and (b)
d. neither (a) nor (b)
____ 11. For which of the following reactions is it important that the species collide with the correct orientation?
a. 2NO(g) + O2(g) 2NO2(g)
b. HCl(g) + H2O(l) H3O+(aq) + Cl(aq)
c. both of them
d. neither of them
____ 12. Which of the following is true?
a. decreasing the activation energy decreases the reaction rate
b. decreasing the activation energy increases the reaction rate
c. the activation energy of an exothermic reaction is negative
d. there is no relationship between activation energy and reaction rate
____ 13. Which of the following is true?
a. decreasing the activation increases the reaction rate
b. the activation energy for an exothermic reaction is negative
c. both (a) and (b)
d. neither (a) nor (b)
____ 14. Given that the reaction 2H2(g) + O2(g) 2H2O(g) is exothermic, which of the following is true of the
reaction 2H2O(g) 2H2(g) + O2(g) ?
a. its activation energy is lower than that of 2H2(g) + O2(g) 2H2O(g)
b. its activation energy is higher than that of 2H2(g) + O2(g) 2H2O(g)
c. its activation energy is the same as that of 2H 2(g) + O2(g) 2H2O(g)
d. there is no relationship between its activation energy and that of 2H 2(g) + O2(g)
2H2O(g)
____ 15. Given that the reaction N2(g) + 2O2(g) 2NO2(g) is endothermic, which of the following is true of
the reaction 2NO2(g) N2(g) + 2O2(g) ?
a. its activation energy is lower than that of N2(g) + 2O2(g) 2NO2(g)
b. its activation energy is higher than that of N2(g) + 2O2(g) 2NO2(g)
c. its activation energy is the same as that of N 2(g) + 2O2(g) 2NO2(g)
d. there is no relationship between its activation energy and that of N 2(g) + 2O2(g)
2NO2(g)
____ 16. In a particular chemical reaction 4 bonds are broken and 3 bonds are formed. Based only on this
information, which of the following is true?
a. the reaction has a high activation energy
b. the reaction is endothermic
c. the reaction is exothermic
d. we cannot determine which of the above is true
____ 17. Sodium chloride and silver nitrate react to produce silver chloride and sodium nitrate? Which of the
following will result in the fastest reaction between sodium chloride and silver nitrate?
a. crystals of the two reactants are placed in a mortar and ground up
b. large crystals of the two reactants are placed in contact with one another
c. powdered samples of the two reactants are mixed together
d. solutions of the two reactants are mixed together
____ 18. If a chemist wishes to carry out a reaction in which one reactant is a solid and one is a liquid, which of the
following will be most effective in speeding up the reaction?
a. adding more liquid reactant
b. grinding the solid to a form a powder
c. placing a larger crystal of the solid in the same volume of liquid reactant
d. none of the above will have a significant effect on the rate of reaction
____ 19. If a chemist wishes to carry out a reaction in which one reactant is a solid and one is a liquid, which of the
following will be most effective in speeding up the reaction?
a. adding more liquid reactant
b. grinding the solid to a form a powder
c. placing a larger crystal of the solid in the same volume of liquid reactant
d. all of the above will be equally effective
____ 20. Which of the following statements is true?
a. doubling the concentration of a reactant always doubles the rate of a reaction
b. doubling the concentration of a reactant often doubles the rate of a reaction
c. doubling the concentration of a reactant usually has no effect on the rate of a reaction
d. doubling the concentration of a reactant usually slows down the rate of a reaction
____ 21. The rate of reaction for the decomposition of hydrogen peroxide to yield water and oxygen is given by the
equation: Rate = k[H2O2]
What units are associated with the rate constant k?
a. minutes b. 1/minutes c. moles/minute d. none of these
____ 22. Which of the following does not result from increasing the temperature of a reaction?
a. a larger fraction of the collisions are effective collisions
b. the concentrations of the reactants are increased
c. there are more collisions
d. none, all of the above are a result of increasing the temperature
____ 23. Which of the following is true of fevers?
a. an increase in body temperature never has beneficial effects
b. a 1°C increase in temperature can be protective
c. a 3°C increase in temperature is invariably fatal
d. none of the above is true
____ 24. A catalyst speeds up a chemical reaction as a result of which of the following?
a. it increases the number of collisions between reacting molecules
b. it makes the reaction more endothermic
c. it makes the reaction more exothermic
d. it provides an alternative reaction pathway
____ 25. A catalyst speeds up a chemical reaction as a result of which of the following?
a. it increases the number of collisions between reacting molecules
b. it makes the reaction more endothermic
c. it makes the reaction more exothermic
d. none of the above
____ 26. Drug manufacturers use which of the following when making time release drugs?
a. control of the thickness of a drug coating c. both (a) and (b)
 b. control of the size d. neither (a) nor (b)
____ 27. What is the purpose of the enteric coating of aspirin?
a. to control time release of the drug in the stomach
b. to insure drug release prior to the drug reaching the stomach
c. to insure drug release in the stomach
d. to insure drug release in the intestine
____ 28. For the reaction PCl3(g) + Cl2(g) PCl5(g) which of the following is true once the reaction has reached
equilibrium?
a. the concentration of PCl3 is zero
b. the concentration of PCl5 is always greater than that of Cl2
c. the concentrations of PCl3 and Cl2 are always equal
d. none of the above
____ 29. For the reaction PCl3(g) + Cl2(g) PCl5(g) which of the following is true once the reaction has reached
equilibrium?
a. the concentration of PCl3 is zero
b. the concentration of PCl3 remains constant
c. the concentrations of PCl3 and Cl2 are always equal
d. none of the above
____ 30. For the reaction PCl3(g) + Cl2(g) PCl5(g) which of the following is true once the reaction has reached
equilibrium?
a. the concentration of PCl3 remains constant
b. the concentrations of PCl3 and Cl2 are always equal
c. both (a) and (b) are true
d. neither (a) nor (b) is true
____ 31. We must know which of the following in order to write the equilibrium constant for a chemical reaction?
a. the balanced chemical equation for the reaction
b. the rate at which the reaction occurs
c. both (a) and (b)
d. neither (a) nor (b)
____ 32. Which of the following symbols is used to denote a reversible reaction?
a.  b.  c. d. 
____ 33. For the reaction 2H2O(g) 2H2(g) + O2(g) which of the following is the equilibrium constant
expression?
a. K = [H2][O2]/[H2O] c. K = [H2O]2/[H2]2[O2]
b. K = [H2O]/[H2][O2] d. K = [H2]2[O2]/[H2O]2
____ 34. For the reaction 2NH3(g) 3H2(g) + N2(g) which of the following is the equilibrium constant
expression?
a. K = [H2][N2]/[NH3] c. K = [H2]3[N2]/[NH3]2
b. K = [NH3]/[H2][N2] d. K = [NH3]2/[H2]3[N2]
____ 35. For the reaction 2NOCl(g) 2NO(g) + Cl2(g) at 25°C equilibrium is established when [NOCl] = 2.6 M,
[NO] = 1.4 M and [Cl2] = 0.34 M. What is the equilibrium constant for this reaction?
a. 0.099 b. 0.18 c. 5.4 d. 10
____ 36. For the reaction 2NO(g) + Cl2(g) 2NOCl(g) at 25°C equilibrium is established when [NOCl] = 2.6 M,
[NO] = 1.4 M and [Cl2] = 0.34 M. What is the equilibrium constant for this reaction?
a. 0.099 b. 0.18 c. 5.4 d. 10
____ 37. Which of the following could be the equilibrium constant for a reaction which proceeds very far in the
direction of the products?
a. 1  1015 b. 1  102 c. 1  102 d. 1  1015
____ 38. Which of the following could be the equilibrium constant for a reaction which does not yield a significant
concentration of products?
a. 1  10 -15 b. 1  10 -2 c. 1  102 d. 1  1015
____ 39. Which of the following is the equilibrium constant expression for the reaction CH 3COOH(l) + C2H5OH(l)
CH3COOC2H5(l) + H2O(l)?
a. K = [CH3COOH][C2H5OH]/[CH3COOC2H5][H2O]
b. K = [CH3COOC2H5][H2O]/[CH3COOH][C2H5OH]
c. K = [CH3COOH][C2H5OH]/[CH3COOC2H5]
d. K = [CH3COOC2H5]/[CH3COOH][C2H5OH]
____ 40. A particular reaction has an equilibrium constant of 1  1020. Which of the following best describes the
relationship between the equilibrium constant and the reaction rate?
a. because the equilibrium constant is large the reaction proceeds rapidly
b. there is no relationship between the size of the equilibrium constant and the rate of the
reaction
c. both (a) and (b) are true
d. neither (a) nor (b) is true
____ 41. A particular reaction has an equilibrium constant of 1  10-15. Which of the following best describes the
relationship between the equilibrium constant and the reaction rate?
a. because the equilibrium constant is small the reaction proceeds slowly
b. there is no relationship between the size of the equilibrium constant and the rate of the
reaction
c. both (a) and (b) are true
d. neither (a) nor (b) is true
____ 42. What is the effect of adding C2H5OH(l) to a container in which the reaction CH3COOH(l) + C2H5OH(l)
CH3COOC2H5(l) + H2O(l) has reached equilibrium?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 43. What is the effect of adding H2O(l) to a container in which the reaction CH3COOH(l) + C2H5OH(l)
CH3COOC2H5(l) + H2O(l) has reached equilibrium?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 44. What is the effect of removing CH3COOC2H5(l) from a container in which the reaction CH 3COOH(l) +
C2H5OH(l) CH3COOC2H5(l) + H2O(l) has reached equilibrium?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 45. What is the effect of removing H2O(l) from a container in which the reaction CH3COOH(l) + C2H5OH(l)
CH3COOC2H5(l) + H2O(l) has reached equilibrium?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 46. Which of the following describes the effect of raising the temperature of an exothermic reaction which
has not yet reached equilibrium?
 a. the rate of reaction slows and less product is produced
b. the rate of reaction slows, but more product is produced
c. the rate of reaction speeds up, but less product is produced
d. the rate of reaction speeds up and more product is produced
____ 47. Which of the following describes the effect of raising the temperature of an endothermic reaction which
has not yet reached equilibrium?
a. the rate of reaction slows and less product is produced
b. the rate of reaction slows, but more product is produced
c. the rate of reaction speeds up, but less product is produced
d. the rate of reaction speeds up and more product is produced
____ 48. If the exothermic reaction 2H2(g) + O2(g) 2H2O(g) has reached equilibrium, what is the effect of
raising the temperature of the reaction vessel?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the initial temperature
____ 49. If the exothermic reaction 2H2(g) + O2(g) 2H2O(g) has reached equilibrium, what is the effect of
lowering the temperature of the reaction vessel?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the initial temperature
____ 50. If the reaction O2(g) + 4ClO2(g) 2Cl2O5(g) has reached equilibrium, what is the effect of doubling the
volume of the reaction vessel?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 51. If the reaction O2(g) + 4ClO2(g) 2Cl2O5(g) has reached equilibrium, what is the effect of halving the
volume of the reaction vessel?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 52. If the reaction 3H2(g) + N2(g) 2NH3(g) has reached equilibrium, what is the effect of halving the
volume of the reaction vessel?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 53. If the reaction H2(g) + Cl2(g) 2HCl(g) has reached equilibrium, what is the effect of doubling the
volume of the reaction vessel?
a. the reaction will shift left to right
b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 54. If the reaction H2(g) + Cl2(g) 2HCl(g) has reached equilibrium, what is the effect of halving the
volume of the reaction vessel?
a. the reaction will shift left to right
 b. the reaction will shift right to left
c. there will be no effect
d. what happens depends on the temperature
____ 55. Which of the following is true of a catalyst for a reaction?
a. it decreases the equilibrium constant for the reaction
b. it increases the equilibrium constant for the reaction
c. it has no effect on the equilibrium constant for the reaction
d. any of the above, depending on the reaction involved